C31H37NO5 — CID 3371199
3-[3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-oxopropyl]-4,8-dimethyl-7-[(2-methylphenyl)methoxy]chromen-2-one (PubChem CID 3371199) has the molecular formula C31H37NO5 and a molecular weight of 503.64 g/mol. Its IUPAC name is 3-[3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-oxopropyl]-4,8-dimethyl-7-[(2-methylphenyl)methoxy]chromen-2-one.
| Compound Name | 3-[3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-oxopropyl]-4,8-dimethyl-7-[(2-methylphenyl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 3371199 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 3-[3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-oxopropyl]-4,8-dimethyl-7-[(2-methylphenyl)methoxy]chromen-2-one |
| SMILES | Cc1ccccc1COc1ccc2c(C)c(CCC(=O)N3CCC4(O)CCCCC4C3)c(=O)oc2c1C |
| InChI | InChI=1S/C31H37NO5/c1-20-8-4-5-9-23(20)19-36-27-13-11-25-21(2)26(30(34)37-29(25)22(27)3)12-14-28(33)32-17-16-31(35)15-7-6-10-24(31)18-32/h4-5,8-9,11,13,24,35H,6-7,10,12,14-19H2,1-3H3 |
| InChIKey | MQIRGEZZIJLQNY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|