C16H19NO4 — CID 3371593
1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 3371593) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 3371593 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | COc1ccc(CCN2C(=O)C(C)=C(C)C2=O)cc1OC |
| InChI | InChI=1S/C16H19NO4/c1-10-11(2)16(19)17(15(10)18)8-7-12-5-6-13(20-3)14(9-12)21-4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | RCIYSNZHZUMGPX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|