C25H22FN3O4 — CID 3371767
2-[3-[(4-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-phenylacetamide (PubChem CID 3371767) has the molecular formula C25H22FN3O4 and a molecular weight of 447.47 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-phenylacetamide.
| Compound Name | 2-[3-[(4-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 3371767 |
| Molecular Formula | C25H22FN3O4 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-phenylacetamide |
| SMILES | COc1ccc(N2C(=O)C(CC(=O)Nc3ccccc3)N(Cc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H22FN3O4/c1-33-21-13-11-20(12-14-21)29-24(31)22(15-23(30)27-19-5-3-2-4-6-19)28(25(29)32)16-17-7-9-18(26)10-8-17/h2-14,22H,15-16H2,1H3,(H,27,30) |
| InChIKey | OCRHPNICBFZMHV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|