C7H12N2O2 — CID 3371821
2-cyano-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 3371821) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-cyano-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-cyano-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 3371821 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 2-cyano-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)CC#N |
| InChI | InChI=1S/C7H12N2O2/c1-6(5-11-2)9-7(10)3-4-8/h6H,3,5H2,1-2H3,(H,9,10) |
| InChIKey | ZBWKHRRVPJVXHC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |