About 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid
4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid (PubChem CID 3372165) has the molecular formula C22H14N2O2S3
and a molecular weight of 434.57 g/mol. Its IUPAC name is 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid |
| PubChem CID | 3372165 |
| Molecular Formula | C22H14N2O2S3 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid |
| SMILES | N#Cc1c(-c2cccs2)cc(-c2cccs2)nc1SCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H14N2O2S3/c23-12-17-16(19-3-1-9-27-19)11-18(20-4-2-10-28-20)24-21(17)29-13-14-5-7-15(8-6-14)22(25)26/h1-11H,13H2,(H,25,26) |
| InChIKey | SRYHLJUVSCMIDM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid?
The IUPAC name of 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid (CID 3372165) is 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid.
What is the SMILES notation for 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid?
The canonical SMILES for 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid is N#Cc1c(-c2cccs2)cc(-c2cccs2)nc1SCc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid?
The InChIKey is SRYHLJUVSCMIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14N2O2S3/c23-12-17-16(19-3-1-9-27-19)11-18(20-4-2-10-28-20)24-21(17)29-13-14-5-7-15(8-6-14)22(25)26/h1-11H,13H2,(H,25,26).
What are the key properties of 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid?
4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid has a molecular weight of 434.57 g/mol, XLogP of 6.40, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)sulfanylmethyl]benzoic acid is sourced from PubChem (CID 3372165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).