C21H28N4O4 — CID 3372372
2-[4-[2-(diethylamino)ethyl-methylamino]-3-nitrophenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 3372372) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[4-[2-(diethylamino)ethyl-methylamino]-3-nitrophenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[4-[2-(diethylamino)ethyl-methylamino]-3-nitrophenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 3372372 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-[4-[2-(diethylamino)ethyl-methylamino]-3-nitrophenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCN(CC)CCN(C)c1ccc(N2C(=O)C3CC=CCC3C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H28N4O4/c1-4-23(5-2)13-12-22(3)18-11-10-15(14-19(18)25(28)29)24-20(26)16-8-6-7-9-17(16)21(24)27/h6-7,10-11,14,16-17H,4-5,8-9,12-13H2,1-3H3 |
| InChIKey | HBENUUNTQSRYDY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|