C22H21Cl2N3O3S — CID 3372529
5-[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]-11-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 3372529) has the molecular formula C22H21Cl2N3O3S and a molecular weight of 478.40 g/mol. Its IUPAC name is 5-[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]-11-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | 5-[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]-11-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 3372529 |
| Molecular Formula | C22H21Cl2N3O3S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 5-[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]-11-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | CCN1CCc2c(sc3c2C(=O)NC(c2ccc(COc4ccc(Cl)c(Cl)c4)o2)N3)C1 |
| InChI | InChI=1S/C22H21Cl2N3O3S/c1-2-27-8-7-14-18(10-27)31-22-19(14)21(28)25-20(26-22)17-6-4-13(30-17)11-29-12-3-5-15(23)16(24)9-12/h3-6,9,20,26H,2,7-8,10-11H2,1H3,(H,25,28) |
| InChIKey | QCVIRPUYBZGICY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |