About 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea
1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea (PubChem CID 3372994) has the molecular formula C14H12FN3O2S
and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea.
Molecular Properties
| Compound Name | 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea |
| PubChem CID | 3372994 |
| Molecular Formula | C14H12FN3O2S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea |
| SMILES | Oc1ccc(C=NNC(=S)Nc2ccc(F)cc2)c(O)c1 |
| InChI | InChI=1S/C14H12FN3O2S/c15-10-2-4-11(5-3-10)17-14(21)18-16-8-9-1-6-12(19)7-13(9)20/h1-8,19-20H,(H2,17,18,21) |
| InChIKey | GAXBQBOPPIAGDM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea?
The IUPAC name of 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea (CID 3372994) is 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea.
What is the SMILES notation for 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea?
The canonical SMILES for 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea is Oc1ccc(C=NNC(=S)Nc2ccc(F)cc2)c(O)c1.
What is the InChIKey of 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea?
The InChIKey is GAXBQBOPPIAGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3O2S/c15-10-2-4-11(5-3-10)17-14(21)18-16-8-9-1-6-12(19)7-13(9)20/h1-8,19-20H,(H2,17,18,21).
What are the key properties of 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea?
1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea has a molecular weight of 305.33 g/mol, XLogP of 2.56, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dihydroxyphenyl)methylideneamino]-3-(4-fluorophenyl)thiourea is sourced from PubChem (CID 3372994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).