C26H29ClN2O5 — CID 3373046
methyl 4-[3-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 3373046) has the molecular formula C26H29ClN2O5 and a molecular weight of 484.98 g/mol. Its IUPAC name is methyl 4-[3-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[3-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 3373046 |
| Molecular Formula | C26H29ClN2O5 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | methyl 4-[3-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | CCN(CC)CCCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)C1c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C26H29ClN2O5/c1-4-28(5-2)15-6-16-29-22(17-7-9-19(10-8-17)26(33)34-3)21(24(31)25(29)32)23(30)18-11-13-20(27)14-12-18/h7-14,22,30H,4-6,15-16H2,1-3H3 |
| InChIKey | SACIWFDHBRYJKS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|