C24H34ClN3O4 — CID 3373531
N-butyl-2-[[2-(4-chlorophenoxy)acetyl]-(3-methoxypropyl)amino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide (PubChem CID 3373531) has the molecular formula C24H34ClN3O4 and a molecular weight of 464.01 g/mol. Its IUPAC name is N-butyl-2-[[2-(4-chlorophenoxy)acetyl]-(3-methoxypropyl)amino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide.
| Compound Name | N-butyl-2-[[2-(4-chlorophenoxy)acetyl]-(3-methoxypropyl)amino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3373531 |
| Molecular Formula | C24H34ClN3O4 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-butyl-2-[[2-(4-chlorophenoxy)acetyl]-(3-methoxypropyl)amino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
| SMILES | CCCCN(Cc1cccn1C)C(=O)CN(CCCOC)C(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H34ClN3O4/c1-4-5-14-27(17-21-8-6-13-26(21)2)23(29)18-28(15-7-16-31-3)24(30)19-32-22-11-9-20(25)10-12-22/h6,8-13H,4-5,7,14-19H2,1-3H3 |
| InChIKey | CDYHGRDUYFTZQO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|