ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate

C13H13NO4 — CID 3373783

IUPACethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate
SMILESCCOC(=O)C1C(=O)CN(c2ccccc2)C1=O
InChIInChI=1S/C13H13NO4/c1-2-18-13(17)11-10(15)8-14(12(11)16)9-6-4-3-5-7-9/h3-7,11H,2,8H2,1H3
InChIKeyWSOUEKNRNFQVLU-UHFFFAOYSA-N
MW247.25 g/mol
LogP0.78
Rot. Bonds3

About ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate

ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate (PubChem CID 3373783) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate.

Molecular Properties

Compound Nameethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate
PubChem CID3373783
Molecular FormulaC13H13NO4
Molecular Weight247.25 g/mol
Exact Mass247.08
IUPAC Nameethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate
SMILESCCOC(=O)C1C(=O)CN(c2ccccc2)C1=O
InChIInChI=1S/C13H13NO4/c1-2-18-13(17)11-10(15)8-14(12(11)16)9-6-4-3-5-7-9/h3-7,11H,2,8H2,1H3
InChIKeyWSOUEKNRNFQVLU-UHFFFAOYSA-N
XLogP0.78
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.25
LogP ≤ 50.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate?
The IUPAC name of ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate (CID 3373783) is ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate.
What is the SMILES notation for ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate?
The canonical SMILES for ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate is CCOC(=O)C1C(=O)CN(c2ccccc2)C1=O.
What is the InChIKey of ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate?
The InChIKey is WSOUEKNRNFQVLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4/c1-2-18-13(17)11-10(15)8-14(12(11)16)9-6-4-3-5-7-9/h3-7,11H,2,8H2,1H3.
What are the key properties of ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate?
ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate has a molecular weight of 247.25 g/mol, XLogP of 0.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,4-dioxo-1-phenylpyrrolidine-3-carboxylate is sourced from PubChem (CID 3373783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).