C26H34N4O3S2 — CID 3373800
3-(2-ethylhexyl)-5-[[7-methyl-4-oxo-2-(oxolan-2-ylmethylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3373800) has the molecular formula C26H34N4O3S2 and a molecular weight of 514.72 g/mol. Its IUPAC name is 3-(2-ethylhexyl)-5-[[7-methyl-4-oxo-2-(oxolan-2-ylmethylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-ethylhexyl)-5-[[7-methyl-4-oxo-2-(oxolan-2-ylmethylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3373800 |
| Molecular Formula | C26H34N4O3S2 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 3-(2-ethylhexyl)-5-[[7-methyl-4-oxo-2-(oxolan-2-ylmethylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCC(CC)CN1C(=O)C(=Cc2c(NCC3CCCO3)nc3ccc(C)cn3c2=O)SC1=S |
| InChI | InChI=1S/C26H34N4O3S2/c1-4-6-8-18(5-2)16-30-25(32)21(35-26(30)34)13-20-23(27-14-19-9-7-12-33-19)28-22-11-10-17(3)15-29(22)24(20)31/h10-11,13,15,18-19,27H,4-9,12,14,16H2,1-3H3 |
| InChIKey | JGJRFIPLQHGOCK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|