C27H21F3N4O2S2 — CID 3374274
2-[2-(1,3-benzothiazol-2-yl)-2-cyano-1-(2,4-dimethylanilino)ethenyl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 3374274) has the molecular formula C27H21F3N4O2S2 and a molecular weight of 554.62 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yl)-2-cyano-1-(2,4-dimethylanilino)ethenyl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yl)-2-cyano-1-(2,4-dimethylanilino)ethenyl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 3374274 |
| Molecular Formula | C27H21F3N4O2S2 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yl)-2-cyano-1-(2,4-dimethylanilino)ethenyl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | Cc1ccc(NC(SCC(=O)Nc2ccc(OC(F)(F)F)cc2)=C(C#N)c2nc3ccccc3s2)c(C)c1 |
| InChI | InChI=1S/C27H21F3N4O2S2/c1-16-7-12-21(17(2)13-16)33-25(20(14-31)26-34-22-5-3-4-6-23(22)38-26)37-15-24(35)32-18-8-10-19(11-9-18)36-27(28,29)30/h3-13,33H,15H2,1-2H3,(H,32,35) |
| InChIKey | RQKAXZMQPILUOR-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|