C30H43N3O2 — CID 3374869
[2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-ethylhexanoate (PubChem CID 3374869) has the molecular formula C30H43N3O2 and a molecular weight of 477.69 g/mol. Its IUPAC name is [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-ethylhexanoate.
| Compound Name | [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 3374869 |
| Molecular Formula | C30H43N3O2 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1ccccc1-c1nc2cc(C)ccn2c1NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C30H43N3O2/c1-9-11-14-22(10-2)28(34)35-24-16-13-12-15-23(24)26-27(32-30(7,8)20-29(4,5)6)33-18-17-21(3)19-25(33)31-26/h12-13,15-19,22,32H,9-11,14,20H2,1-8H3 |
| InChIKey | GWGBLBJHSIZJLR-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|