C23H18Cl2N2O4S — CID 3374951
5-(3,4-dichlorophenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 3374951) has the molecular formula C23H18Cl2N2O4S and a molecular weight of 489.38 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3,4-dichlorophenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3374951 |
| Molecular Formula | C23H18Cl2N2O4S |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1cccc(C(O)=C2C(=O)C(=O)N(c3nccs3)C2c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C23H18Cl2N2O4S/c1-2-9-31-15-5-3-4-14(11-15)20(28)18-19(13-6-7-16(24)17(25)12-13)27(22(30)21(18)29)23-26-8-10-32-23/h3-8,10-12,19,28H,2,9H2,1H3 |
| InChIKey | YIILZWDSZGLCNW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|