C6H7ClF3NO3S — CID 3374968
N-(4-chloro-1,1-dioxothiolan-3-yl)-2,2,2-trifluoroacetamide (PubChem CID 3374968) has the molecular formula C6H7ClF3NO3S and a molecular weight of 265.64 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 3374968 |
| Molecular Formula | C6H7ClF3NO3S |
| Molecular Weight | 265.64 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NC1CS(=O)(=O)CC1Cl)C(F)(F)F |
| InChI | InChI=1S/C6H7ClF3NO3S/c7-3-1-15(13,14)2-4(3)11-5(12)6(8,9)10/h3-4H,1-2H2,(H,11,12) |
| InChIKey | LLAAWODNXJAIKB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.64 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|