About 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one
2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one (PubChem CID 3375106) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one.
Molecular Properties
| Compound Name | 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one |
| PubChem CID | 3375106 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one |
| SMILES | CCCOc1cccc2c1CCN(C)C2=O |
| InChI | InChI=1S/C13H17NO2/c1-3-9-16-12-6-4-5-11-10(12)7-8-14(2)13(11)15/h4-6H,3,7-9H2,1-2H3 |
| InChIKey | NRVGIUIDIXFACA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one?
The IUPAC name of 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one (CID 3375106) is 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one.
What is the SMILES notation for 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one?
The canonical SMILES for 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one is CCCOc1cccc2c1CCN(C)C2=O.
What is the InChIKey of 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one?
The InChIKey is NRVGIUIDIXFACA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-3-9-16-12-6-4-5-11-10(12)7-8-14(2)13(11)15/h4-6H,3,7-9H2,1-2H3.
What are the key properties of 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one?
2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one has a molecular weight of 219.28 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-propoxy-3,4-dihydroisoquinolin-1-one is sourced from PubChem (CID 3375106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).