C15H21ClN2O3 — CID 3375156
4-(5-chloro-2-methylanilino)-2-(diethylamino)-4-oxobutanoic acid (PubChem CID 3375156) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 4-(5-chloro-2-methylanilino)-2-(diethylamino)-4-oxobutanoic acid.
| Compound Name | 4-(5-chloro-2-methylanilino)-2-(diethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 3375156 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4-(5-chloro-2-methylanilino)-2-(diethylamino)-4-oxobutanoic acid |
| SMILES | CCN(CC)C(CC(=O)Nc1cc(Cl)ccc1C)C(=O)O |
| InChI | InChI=1S/C15H21ClN2O3/c1-4-18(5-2)13(15(20)21)9-14(19)17-12-8-11(16)7-6-10(12)3/h6-8,13H,4-5,9H2,1-3H3,(H,17,19)(H,20,21) |
| InChIKey | HDIQWCUUBVXIGR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |