C8H6F5NO2S — CID 3375683
N-(2,3,4,5,6-pentafluorophenyl)ethanesulfonamide (PubChem CID 3375683) has the molecular formula C8H6F5NO2S and a molecular weight of 275.20 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)ethanesulfonamide.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 3375683 |
| Molecular Formula | C8H6F5NO2S |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H6F5NO2S/c1-2-17(15,16)14-8-6(12)4(10)3(9)5(11)7(8)13/h14H,2H2,1H3 |
| InChIKey | OFAVGUVCTOGBGW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|