About 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine
4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 3376084) has the molecular formula C8H8N6O3
and a molecular weight of 236.19 g/mol. Its IUPAC name is 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine |
| PubChem CID | 3376084 |
| Molecular Formula | C8H8N6O3 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1cc(Nc2ncnc(N)c2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C8H8N6O3/c1-4-2-5(13-17-4)12-8-6(14(15)16)7(9)10-3-11-8/h2-3H,1H3,(H3,9,10,11,12,13) |
| InChIKey | SFIFILSWVHPVMC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine?
The IUPAC name of 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine (CID 3376084) is 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine.
What is the SMILES notation for 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine?
The canonical SMILES for 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine is Cc1cc(Nc2ncnc(N)c2[N+](=O)[O-])no1.
What is the InChIKey of 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine?
The InChIKey is SFIFILSWVHPVMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N6O3/c1-4-2-5(13-17-4)12-8-6(14(15)16)7(9)10-3-11-8/h2-3H,1H3,(H3,9,10,11,12,13).
What are the key properties of 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine?
4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine has a molecular weight of 236.19 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine is sourced from PubChem (CID 3376084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).