C14H20N4O3 — CID 3376500
1-(2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl)-3-prop-2-enylurea (PubChem CID 3376500) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-(2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl)-3-prop-2-enylurea.
| Compound Name | 1-(2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 3376500 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-(2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NC1CC2C(=O)N3CCCC3C(=O)N2C1 |
| InChI | InChI=1S/C14H20N4O3/c1-2-5-15-14(21)16-9-7-11-13(20)17-6-3-4-10(17)12(19)18(11)8-9/h2,9-11H,1,3-8H2,(H2,15,16,21) |
| InChIKey | TVYHBNGBBRZPIL-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|