C31H40N2O7 — CID 3376761
5-(4-butoxy-3-ethoxyphenyl)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione (PubChem CID 3376761) has the molecular formula C31H40N2O7 and a molecular weight of 552.67 g/mol. Its IUPAC name is 5-(4-butoxy-3-ethoxyphenyl)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione.
| Compound Name | 5-(4-butoxy-3-ethoxyphenyl)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3376761 |
| Molecular Formula | C31H40N2O7 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 5-(4-butoxy-3-ethoxyphenyl)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc(C2C(=C(O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2CCN(CC)CC)cc1OCC |
| InChI | InChI=1S/C31H40N2O7/c1-5-9-16-38-23-12-10-21(19-25(23)37-8-4)28-27(30(35)31(36)33(28)15-14-32(6-2)7-3)29(34)22-11-13-24-26(20-22)40-18-17-39-24/h10-13,19-20,28,34H,5-9,14-18H2,1-4H3 |
| InChIKey | YUVWHCZKIDHOPK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|