About 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine
2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine (PubChem CID 3377519) has the molecular formula C15H12N4
and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine |
| PubChem CID | 3377519 |
| Molecular Formula | C15H12N4 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine |
| SMILES | Cn1c(-c2c[nH]c3ccccc23)nc2cnccc21 |
| InChI | InChI=1S/C15H12N4/c1-19-14-6-7-16-9-13(14)18-15(19)11-8-17-12-5-3-2-4-10(11)12/h2-9,17H,1H3 |
| InChIKey | UVYXQFLPJABTFM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine?
The IUPAC name of 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine (CID 3377519) is 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine.
What is the SMILES notation for 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine?
The canonical SMILES for 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine is Cn1c(-c2c[nH]c3ccccc23)nc2cnccc21.
What is the InChIKey of 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine?
The InChIKey is UVYXQFLPJABTFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4/c1-19-14-6-7-16-9-13(14)18-15(19)11-8-17-12-5-3-2-4-10(11)12/h2-9,17H,1H3.
What are the key properties of 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine?
2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine has a molecular weight of 248.29 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-3-yl)-1-methylimidazo[4,5-c]pyridine is sourced from PubChem (CID 3377519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).