C16H18N4O2S2 — CID 3377650
N-(2,4-dimethylphenyl)-2-[(8-oxo-6,7-dihydro-5H-[1,3,4]thiadiazolo[3,2-a][1,3]diazepin-2-yl)sulfanyl]acetamide (PubChem CID 3377650) has the molecular formula C16H18N4O2S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[(8-oxo-6,7-dihydro-5H-[1,3,4]thiadiazolo[3,2-a][1,3]diazepin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[(8-oxo-6,7-dihydro-5H-[1,3,4]thiadiazolo[3,2-a][1,3]diazepin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3377650 |
| Molecular Formula | C16H18N4O2S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[(8-oxo-6,7-dihydro-5H-[1,3,4]thiadiazolo[3,2-a][1,3]diazepin-2-yl)sulfanyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CSC2=NN3CCCC(=O)N=C3S2)c(C)c1 |
| InChI | InChI=1S/C16H18N4O2S2/c1-10-5-6-12(11(2)8-10)17-14(22)9-23-16-19-20-7-3-4-13(21)18-15(20)24-16/h5-6,8H,3-4,7,9H2,1-2H3,(H,17,22) |
| InChIKey | LDEINFXGQFISMK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |