About 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea
1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea (PubChem CID 3377705) has the molecular formula C13H15N5OS2
and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea.
Molecular Properties
| Compound Name | 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea |
| PubChem CID | 3377705 |
| Molecular Formula | C13H15N5OS2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea |
| SMILES | [H]/N=c1\sc2ccccc2n1CC(=O)NNC(=S)NCC=C |
| InChI | InChI=1S/C13H15N5OS2/c1-2-7-15-13(20)17-16-11(19)8-18-9-5-3-4-6-10(9)21-12(18)14/h2-6,14H,1,7-8H2,(H,16,19)(H2,15,17,20)/b14-12- |
| InChIKey | TVODROWATXFUOR-OWBHPGMISA-N |
| XLogP | 0.86 |
| TPSA | 81.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea?
The IUPAC name of 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea (CID 3377705) is 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea.
What is the SMILES notation for 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea?
The canonical SMILES for 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea is [H]/N=c1\sc2ccccc2n1CC(=O)NNC(=S)NCC=C.
What is the InChIKey of 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea?
The InChIKey is TVODROWATXFUOR-OWBHPGMISA-N. The full InChI is InChI=1S/C13H15N5OS2/c1-2-7-15-13(20)17-16-11(19)8-18-9-5-3-4-6-10(9)21-12(18)14/h2-6,14H,1,7-8H2,(H,16,19)(H2,15,17,20)/b14-12-.
What are the key properties of 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea?
1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea has a molecular weight of 321.43 g/mol, XLogP of 0.86, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(2-imino-1,3-benzothiazol-3-yl)acetyl]amino]-3-prop-2-enylthiourea is sourced from PubChem (CID 3377705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).