About 1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine
1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine (PubChem CID 33780181) has the molecular formula C9H12FNO2S
and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfonyl]ethanamine.
Molecular Properties
| Compound Name | 1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine |
| PubChem CID | 33780181 |
| Molecular Formula | C9H12FNO2S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfonyl]ethanamine |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)CCN)F |
| InChI | InChI=1S/C9H12FNO2S/c10-9-3-1-8(2-4-9)7-14(12,13)6-5-11/h1-4H,5-7,11H2 |
| InChIKey | UHSKPURIOSJUSM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 252 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine?
The IUPAC name of 1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine (CID 33780181) is 2-[(4-fluorophenyl)methylsulfonyl]ethanamine.
What is the SMILES notation for 1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine?
The canonical SMILES for 1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine is C1=CC(=CC=C1CS(=O)(=O)CCN)F.
What is the InChIKey of 1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine?
The InChIKey is UHSKPURIOSJUSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FNO2S/c10-9-3-1-8(2-4-9)7-14(12,13)6-5-11/h1-4H,5-7,11H2.
What are the key properties of 1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine?
1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine has a molecular weight of 217.26 g/mol, XLogP of 0.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-{[(4-Fluorophenyl)methyl]sulfonyl}eth-2-ylamine is sourced from PubChem (CID 33780181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).