About S-(2-acetamidoethyl) hexadecanethioate
S-(2-acetamidoethyl) hexadecanethioate (PubChem CID 3378216) has the molecular formula C20H39NO2S
and a molecular weight of 357.60 g/mol. Its IUPAC name is S-(2-acetamidoethyl) hexadecanethioate.
Molecular Properties
| Compound Name | S-(2-acetamidoethyl) hexadecanethioate |
| PubChem CID | 3378216 |
| Molecular Formula | C20H39NO2S |
| Molecular Weight | 357.60 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | S-(2-acetamidoethyl) hexadecanethioate |
| SMILES | CCCCCCCCCCCCCCCC(=O)SCCNC(C)=O |
| InChI | InChI=1S/C20H39NO2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(23)24-18-17-21-19(2)22/h3-18H2,1-2H3,(H,21,22) |
| InChIKey | GDVZALUOXPTSHD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-acetamidoethyl) hexadecanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-acetamidoethyl) hexadecanethioate?
The IUPAC name of S-(2-acetamidoethyl) hexadecanethioate (CID 3378216) is S-(2-acetamidoethyl) hexadecanethioate.
What is the SMILES notation for S-(2-acetamidoethyl) hexadecanethioate?
The canonical SMILES for S-(2-acetamidoethyl) hexadecanethioate is CCCCCCCCCCCCCCCC(=O)SCCNC(C)=O.
What is the InChIKey of S-(2-acetamidoethyl) hexadecanethioate?
The InChIKey is GDVZALUOXPTSHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39NO2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(23)24-18-17-21-19(2)22/h3-18H2,1-2H3,(H,21,22).
What are the key properties of S-(2-acetamidoethyl) hexadecanethioate?
S-(2-acetamidoethyl) hexadecanethioate has a molecular weight of 357.60 g/mol, XLogP of 5.86, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-acetamidoethyl) hexadecanethioate is sourced from PubChem (CID 3378216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).