C50H44N2O2 — CID 3378842
5-[4-[4-(2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl)phenyl]phenyl]-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one (PubChem CID 3378842) has the molecular formula C50H44N2O2 and a molecular weight of 704.91 g/mol. Its IUPAC name is 5-[4-[4-(2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl)phenyl]phenyl]-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one.
| Compound Name | 5-[4-[4-(2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl)phenyl]phenyl]-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
|---|---|
| PubChem CID | 3378842 |
| Molecular Formula | C50H44N2O2 |
| Molecular Weight | 704.91 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | 5-[4-[4-(2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl)phenyl]phenyl]-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)c1c(ccc3ccccc13)NC2c1ccc(-c2ccc(C3Nc4ccc5ccccc5c4C4=C3C(=O)CC(C)(C)C4)cc2)cc1 |
| InChI | InChI=1S/C50H44N2O2/c1-49(2)25-37-43-35-11-7-5-9-31(35)21-23-39(43)51-47(45(37)41(53)27-49)33-17-13-29(14-18-33)30-15-19-34(20-16-30)48-46-38(26-50(3,4)28-42(46)54)44-36-12-8-6-10-32(36)22-24-40(44)52-48/h5-24,47-48,51-52H,25-28H2,1-4H3 |
| InChIKey | DJHLSSKVULWYMZ-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.91 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |