C22H13ClF2N4O2 — CID 3378917
1-(3-chlorophenyl)-3-(3,4-difluorophenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3378917) has the molecular formula C22H13ClF2N4O2 and a molecular weight of 438.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(3,4-difluorophenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(3-chlorophenyl)-3-(3,4-difluorophenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3378917 |
| Molecular Formula | C22H13ClF2N4O2 |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(3,4-difluorophenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3cccc(Cl)c3)OC(c3ccc(F)c(F)c3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C22H13ClF2N4O2/c1-12-21(11-28)19(29)31-22(12,14-3-2-4-15(23)8-14)30-18(20(21,9-26)10-27)13-5-6-16(24)17(25)7-13/h2-8,12,18,29H,1H3/b29-19- |
| InChIKey | GLHNPALEKBINIU-CEUNXORHSA-N |
| XLogP | 4.73 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|