C23H26N2O4 — CID 3379091
1-(4-tert-butylphenyl)-3-(3,4-dihydroxyphenyl)-5-propylpyrazole-4-carboxylic acid (PubChem CID 3379091) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(3,4-dihydroxyphenyl)-5-propylpyrazole-4-carboxylic acid.
| Compound Name | 1-(4-tert-butylphenyl)-3-(3,4-dihydroxyphenyl)-5-propylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 3379091 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(3,4-dihydroxyphenyl)-5-propylpyrazole-4-carboxylic acid |
| SMILES | CCCc1c(C(=O)O)c(-c2ccc(O)c(O)c2)nn1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H26N2O4/c1-5-6-17-20(22(28)29)21(14-7-12-18(26)19(27)13-14)24-25(17)16-10-8-15(9-11-16)23(2,3)4/h7-13,26-27H,5-6H2,1-4H3,(H,28,29) |
| InChIKey | KZLHMSUTMLTCAD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|