C9H8N8O2S — CID 3379405
6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-7H-purin-2-amine (PubChem CID 3379405) has the molecular formula C9H8N8O2S and a molecular weight of 292.28 g/mol. Its IUPAC name is 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-7H-purin-2-amine.
| Compound Name | 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 3379405 |
| Molecular Formula | C9H8N8O2S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-7H-purin-2-amine |
| SMILES | Cn1cnc([N+](=O)[O-])c1Sc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H8N8O2S/c1-16-3-13-6(17(18)19)8(16)20-7-4-5(12-2-11-4)14-9(10)15-7/h2-3H,1H3,(H3,10,11,12,14,15) |
| InChIKey | YFTWHEBLORWGNI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|