About 3,5-dibromo-2,4-dihydroxybenzoic acid
3,5-dibromo-2,4-dihydroxybenzoic acid (PubChem CID 3379773) has the molecular formula C7H4Br2O4
and a molecular weight of 311.91 g/mol. Its IUPAC name is 3,5-dibromo-2,4-dihydroxybenzoic acid.
Molecular Properties
| Compound Name | 3,5-dibromo-2,4-dihydroxybenzoic acid |
| PubChem CID | 3379773 |
| Molecular Formula | C7H4Br2O4 |
| Molecular Weight | 311.91 g/mol |
| Exact Mass | 309.85 |
| IUPAC Name | 3,5-dibromo-2,4-dihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(Br)c(O)c(Br)c1O |
| InChI | InChI=1S/C7H4Br2O4/c8-3-1-2(7(12)13)5(10)4(9)6(3)11/h1,10-11H,(H,12,13) |
| InChIKey | QFRWOMSBYNAESH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.91 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dibromo-2,4-dihydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-2,4-dihydroxybenzoic acid?
The IUPAC name of 3,5-dibromo-2,4-dihydroxybenzoic acid (CID 3379773) is 3,5-dibromo-2,4-dihydroxybenzoic acid.
What is the SMILES notation for 3,5-dibromo-2,4-dihydroxybenzoic acid?
The canonical SMILES for 3,5-dibromo-2,4-dihydroxybenzoic acid is O=C(O)c1cc(Br)c(O)c(Br)c1O.
What is the InChIKey of 3,5-dibromo-2,4-dihydroxybenzoic acid?
The InChIKey is QFRWOMSBYNAESH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Br2O4/c8-3-1-2(7(12)13)5(10)4(9)6(3)11/h1,10-11H,(H,12,13).
What are the key properties of 3,5-dibromo-2,4-dihydroxybenzoic acid?
3,5-dibromo-2,4-dihydroxybenzoic acid has a molecular weight of 311.91 g/mol, XLogP of 2.32, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-2,4-dihydroxybenzoic acid is sourced from PubChem (CID 3379773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).