C24H30O3 — CID 3381031
16-(furan-3-ylmethylidene)-3-hydroxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 3381031) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 16-(furan-3-ylmethylidene)-3-hydroxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | 16-(furan-3-ylmethylidene)-3-hydroxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 3381031 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 16-(furan-3-ylmethylidene)-3-hydroxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC12CCC3C(C=CC4CC(O)CCC43C)C1CC(=Cc1ccoc1)C2=O |
| InChI | InChI=1S/C24H30O3/c1-23-8-5-18(25)13-17(23)3-4-19-20(23)6-9-24(2)21(19)12-16(22(24)26)11-15-7-10-27-14-15/h3-4,7,10-11,14,17-21,25H,5-6,8-9,12-13H2,1-2H3 |
| InChIKey | IBIVUTHWOTUMDZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|