C17H16Cl2N4O2 — CID 3381183
2-amino-6-(3,4-dichlorophenyl)-4,4-diethoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3381183) has the molecular formula C17H16Cl2N4O2 and a molecular weight of 379.25 g/mol. Its IUPAC name is 2-amino-6-(3,4-dichlorophenyl)-4,4-diethoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-6-(3,4-dichlorophenyl)-4,4-diethoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3381183 |
| Molecular Formula | C17H16Cl2N4O2 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-amino-6-(3,4-dichlorophenyl)-4,4-diethoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCOC1(OCC)N=C(N)C2(C#N)C(c3ccc(Cl)c(Cl)c3)C12C#N |
| InChI | InChI=1S/C17H16Cl2N4O2/c1-3-24-17(25-4-2)16(9-21)13(15(16,8-20)14(22)23-17)10-5-6-11(18)12(19)7-10/h5-7,13H,3-4H2,1-2H3,(H2,22,23) |
| InChIKey | KLRIAEOWFNUOKL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|