C36H46F3NO5 — CID 3382291
ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate (PubChem CID 3382291) has the molecular formula C36H46F3NO5 and a molecular weight of 629.76 g/mol. Its IUPAC name is ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate.
| Compound Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 3382291 |
| Molecular Formula | C36H46F3NO5 |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.33 |
| IUPAC Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3cccc(C(F)(F)F)c3)CC(O)CCC(C)=CCCC21C)C(=O)OCC |
| InChI | InChI=1S/C36H46F3NO5/c1-5-19-40(33(43)45-6-2)23-35(44)18-16-31-29-15-13-25(20-28(41)14-12-24(3)9-8-17-34(31,35)4)21-30(29)32(42)26-10-7-11-27(22-26)36(37,38)39/h7,9-11,13,15,21-22,28,31,41,44H,5-6,8,12,14,16-20,23H2,1-4H3 |
| InChIKey | VNZZYOBOYBIJLI-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|