About [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate (PubChem CID 3382804) has the molecular formula C15H20N2O4S
and a molecular weight of 324.40 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate.
Molecular Properties
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate |
| PubChem CID | 3382804 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate |
| SMILES | O=C(COC(=O)CC1CCCCC1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C15H20N2O4S/c18-13(16-17-15(20)12-7-4-8-22-12)10-21-14(19)9-11-5-2-1-3-6-11/h4,7-8,11H,1-3,5-6,9-10H2,(H,16,18)(H,17,20) |
| InChIKey | XOYNBCIOXGRZOA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate?
The IUPAC name of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate (CID 3382804) is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate.
What is the SMILES notation for [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate?
The canonical SMILES for [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate is O=C(COC(=O)CC1CCCCC1)NNC(=O)c1cccs1.
What is the InChIKey of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate?
The InChIKey is XOYNBCIOXGRZOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O4S/c18-13(16-17-15(20)12-7-4-8-22-12)10-21-14(19)9-11-5-2-1-3-6-11/h4,7-8,11H,1-3,5-6,9-10H2,(H,16,18)(H,17,20).
What are the key properties of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate?
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate has a molecular weight of 324.40 g/mol, XLogP of 2.02, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-cyclohexylacetate is sourced from PubChem (CID 3382804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).