About methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate
methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate (PubChem CID 3382837) has the molecular formula C17H19NO5S
and a molecular weight of 349.41 g/mol. Its IUPAC name is methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate.
Molecular Properties
| Compound Name | methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate |
| PubChem CID | 3382837 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cccs1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H19NO5S/c1-21-13-7-6-11(9-14(13)22-2)12(10-16(19)23-3)18-17(20)15-5-4-8-24-15/h4-9,12H,10H2,1-3H3,(H,18,20) |
| InChIKey | BSKHUGUNPZKGLO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate?
The IUPAC name of methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate (CID 3382837) is methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate.
What is the SMILES notation for methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate?
The canonical SMILES for methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate is COC(=O)CC(NC(=O)c1cccs1)c1ccc(OC)c(OC)c1.
What is the InChIKey of methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate?
The InChIKey is BSKHUGUNPZKGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO5S/c1-21-13-7-6-11(9-14(13)22-2)12(10-16(19)23-3)18-17(20)15-5-4-8-24-15/h4-9,12H,10H2,1-3H3,(H,18,20).
What are the key properties of methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate?
methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate has a molecular weight of 349.41 g/mol, XLogP of 2.80, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate is sourced from PubChem (CID 3382837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).