C18H11Cl2FN4O4 — CID 3382954
2,4-dichloro-N-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide (PubChem CID 3382954) has the molecular formula C18H11Cl2FN4O4 and a molecular weight of 437.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3382954 |
| Molecular Formula | C18H11Cl2FN4O4 |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | 2,4-dichloro-N-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide |
| SMILES | O=C(NN=CC1C(=O)NC(=O)N(c2ccccc2F)C1=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H11Cl2FN4O4/c19-9-5-6-10(12(20)7-9)16(27)24-22-8-11-15(26)23-18(29)25(17(11)28)14-4-2-1-3-13(14)21/h1-8,11H,(H,24,27)(H,23,26,29) |
| InChIKey | BDPZYCJJWGZYAG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|