About 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one
4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one (PubChem CID 3383533) has the molecular formula C23H15NO3
and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one.
Molecular Properties
| Compound Name | 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one |
| PubChem CID | 3383533 |
| Molecular Formula | C23H15NO3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one |
| SMILES | COc1ccc(-c2cnc(-c3cccc4c3-c3ccccc3C4=O)o2)cc1 |
| InChI | InChI=1S/C23H15NO3/c1-26-15-11-9-14(10-12-15)20-13-24-23(27-20)19-8-4-7-18-21(19)16-5-2-3-6-17(16)22(18)25/h2-13H,1H3 |
| InChIKey | SVICLWPFAQYZLX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one?
The IUPAC name of 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one (CID 3383533) is 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one.
What is the SMILES notation for 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one?
The canonical SMILES for 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one is COc1ccc(-c2cnc(-c3cccc4c3-c3ccccc3C4=O)o2)cc1.
What is the InChIKey of 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one?
The InChIKey is SVICLWPFAQYZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15NO3/c1-26-15-11-9-14(10-12-15)20-13-24-23(27-20)19-8-4-7-18-21(19)16-5-2-3-6-17(16)22(18)25/h2-13H,1H3.
What are the key properties of 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one?
4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one has a molecular weight of 353.38 g/mol, XLogP of 5.23, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]fluoren-9-one is sourced from PubChem (CID 3383533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).