C18H17N3O4S — CID 3383817
2-[3-(4-nitrophenyl)prop-2-enoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 3383817) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-[3-(4-nitrophenyl)prop-2-enoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-(4-nitrophenyl)prop-2-enoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 3383817 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[3-(4-nitrophenyl)prop-2-enoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)C=Cc2ccc([N+](=O)[O-])cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C18H17N3O4S/c19-17(23)16-13-3-1-2-4-14(13)26-18(16)20-15(22)10-7-11-5-8-12(9-6-11)21(24)25/h5-10H,1-4H2,(H2,19,23)(H,20,22) |
| InChIKey | LNRQKWRBUFOUKD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|