About dichloroiron;1,10-phenanthroline
dichloroiron;1,10-phenanthroline (PubChem CID 3383833) has the molecular formula C12H8Cl2FeN2
and a molecular weight of 306.96 g/mol. Its IUPAC name is dichloroiron;1,10-phenanthroline.
Molecular Properties
| Compound Name | dichloroiron;1,10-phenanthroline |
| PubChem CID | 3383833 |
| Molecular Formula | C12H8Cl2FeN2 |
| Molecular Weight | 306.96 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | dichloroiron;1,10-phenanthroline |
| SMILES | Cl[Fe]Cl.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.2ClH.Fe/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;;;/h1-8H;2*1H;/q;;;+2/p-2 |
| InChIKey | UBCPTWRHTVTGFL-UHFFFAOYSA-L |
| XLogP | 4.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze dichloroiron;1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroiron;1,10-phenanthroline?
The IUPAC name of dichloroiron;1,10-phenanthroline (CID 3383833) is dichloroiron;1,10-phenanthroline.
What is the SMILES notation for dichloroiron;1,10-phenanthroline?
The canonical SMILES for dichloroiron;1,10-phenanthroline is Cl[Fe]Cl.c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of dichloroiron;1,10-phenanthroline?
The InChIKey is UBCPTWRHTVTGFL-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H8N2.2ClH.Fe/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;;;/h1-8H;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroiron;1,10-phenanthroline?
dichloroiron;1,10-phenanthroline has a molecular weight of 306.96 g/mol, XLogP of 4.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroiron;1,10-phenanthroline is sourced from PubChem (CID 3383833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).