C22H14Cl2FNO2 — CID 3384567
3-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one (PubChem CID 3384567) has the molecular formula C22H14Cl2FNO2 and a molecular weight of 414.26 g/mol. Its IUPAC name is 3-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one.
| Compound Name | 3-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 3384567 |
| Molecular Formula | C22H14Cl2FNO2 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 3-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2C1=Cc1cc(Cl)c(OCc2cccc(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H14Cl2FNO2/c23-18-10-14(9-17-16-6-1-2-7-20(16)26-22(17)27)11-19(24)21(18)28-12-13-4-3-5-15(25)8-13/h1-11H,12H2,(H,26,27) |
| InChIKey | QKXUYJBSSMTSOO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|