About [amino(1,2,4-triazol-1-yl)methylidene]azanium
[amino(1,2,4-triazol-1-yl)methylidene]azanium (PubChem CID 3387240) has the molecular formula C3H6N5+
and a molecular weight of 112.12 g/mol. Its IUPAC name is [amino(1,2,4-triazol-1-yl)methylidene]azanium.
Molecular Properties
| Compound Name | [amino(1,2,4-triazol-1-yl)methylidene]azanium |
| PubChem CID | 3387240 |
| Molecular Formula | C3H6N5+ |
| Molecular Weight | 112.12 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | [amino(1,2,4-triazol-1-yl)methylidene]azanium |
| SMILES | NC(=[NH2+])n1cncn1 |
| InChI | InChI=1S/C3H5N5/c4-3(5)8-2-6-1-7-8/h1-2H,(H3,4,5)/p+1 |
| InChIKey | CDIOIIJXUJXYPB-UHFFFAOYSA-O |
| XLogP | -2.80 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.12 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [amino(1,2,4-triazol-1-yl)methylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino(1,2,4-triazol-1-yl)methylidene]azanium?
The IUPAC name of [amino(1,2,4-triazol-1-yl)methylidene]azanium (CID 3387240) is [amino(1,2,4-triazol-1-yl)methylidene]azanium.
What is the SMILES notation for [amino(1,2,4-triazol-1-yl)methylidene]azanium?
The canonical SMILES for [amino(1,2,4-triazol-1-yl)methylidene]azanium is NC(=[NH2+])n1cncn1.
What is the InChIKey of [amino(1,2,4-triazol-1-yl)methylidene]azanium?
The InChIKey is CDIOIIJXUJXYPB-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H5N5/c4-3(5)8-2-6-1-7-8/h1-2H,(H3,4,5)/p+1.
What are the key properties of [amino(1,2,4-triazol-1-yl)methylidene]azanium?
[amino(1,2,4-triazol-1-yl)methylidene]azanium has a molecular weight of 112.12 g/mol, XLogP of -2.80, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [amino(1,2,4-triazol-1-yl)methylidene]azanium is sourced from PubChem (CID 3387240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).