About 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea
3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea (PubChem CID 3387581) has the molecular formula C18H22Cl2N4O
and a molecular weight of 381.31 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea |
| PubChem CID | 3387581 |
| Molecular Formula | C18H22Cl2N4O |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea |
| SMILES | CC(c1cccnc1)N(CCN(C)C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H22Cl2N4O/c1-13(14-5-4-8-21-12-14)24(10-9-23(2)3)18(25)22-15-6-7-16(19)17(20)11-15/h4-8,11-13H,9-10H2,1-3H3,(H,22,25) |
| InChIKey | NUDRYVKIAXEUMG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea?
The IUPAC name of 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea (CID 3387581) is 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea?
The canonical SMILES for 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea is CC(c1cccnc1)N(CCN(C)C)C(=O)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea?
The InChIKey is NUDRYVKIAXEUMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22Cl2N4O/c1-13(14-5-4-8-21-12-14)24(10-9-23(2)3)18(25)22-15-6-7-16(19)17(20)11-15/h4-8,11-13H,9-10H2,1-3H3,(H,22,25).
What are the key properties of 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea?
3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea has a molecular weight of 381.31 g/mol, XLogP of 4.55, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-1-(1-pyridin-3-ylethyl)urea is sourced from PubChem (CID 3387581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).