About N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine
N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine (PubChem CID 3388817) has the molecular formula C21H16Cl2FNO2
and a molecular weight of 404.27 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine.
Molecular Properties
| Compound Name | N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine |
| PubChem CID | 3388817 |
| Molecular Formula | C21H16Cl2FNO2 |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine |
| SMILES | COc1cc(/C=N/c2ccc(Cl)c(Cl)c2)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C21H16Cl2FNO2/c1-26-21-10-14(12-25-16-7-8-17(22)18(23)11-16)6-9-20(21)27-13-15-4-2-3-5-19(15)24/h2-12H,13H2,1H3/b25-12+ |
| InChIKey | UEVREEIQLIAADQ-BRJLIKDPSA-N |
| XLogP | 6.47 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine?
The IUPAC name of N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine (CID 3388817) is N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine.
What is the SMILES notation for N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine?
The canonical SMILES for N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine is COc1cc(/C=N/c2ccc(Cl)c(Cl)c2)ccc1OCc1ccccc1F.
What is the InChIKey of N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine?
The InChIKey is UEVREEIQLIAADQ-BRJLIKDPSA-N. The full InChI is InChI=1S/C21H16Cl2FNO2/c1-26-21-10-14(12-25-16-7-8-17(22)18(23)11-16)6-9-20(21)27-13-15-4-2-3-5-19(15)24/h2-12H,13H2,1H3/b25-12+.
What are the key properties of N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine?
N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine has a molecular weight of 404.27 g/mol, XLogP of 6.47, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dichlorophenyl)-1-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine is sourced from PubChem (CID 3388817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).