C10H7N7S — CID 3388987
4,6,11-triamino-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile (PubChem CID 3388987) has the molecular formula C10H7N7S and a molecular weight of 257.28 g/mol. Its IUPAC name is 4,6,11-triamino-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile.
| Compound Name | 4,6,11-triamino-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile |
|---|---|
| PubChem CID | 3388987 |
| Molecular Formula | C10H7N7S |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4,6,11-triamino-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile |
| SMILES | N#Cc1cc2c(nc1N)sc1c(N)nc(N)nc12 |
| InChI | InChI=1S/C10H7N7S/c11-2-3-1-4-5-6(8(13)17-10(14)15-5)18-9(4)16-7(3)12/h1H,(H2,12,16)(H4,13,14,15,17) |
| InChIKey | YNBPBCOHXAZXMA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 140.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |