C19H16F5N3O3S — CID 3389359
1-(2-methylsulfonyl-1,3-dihydroisoindol-5-yl)-3-[(2,3,4,5,6-pentafluorophenyl)methyl]imidazolidin-2-one (PubChem CID 3389359) has the molecular formula C19H16F5N3O3S and a molecular weight of 461.41 g/mol. Its IUPAC name is 1-(2-methylsulfonyl-1,3-dihydroisoindol-5-yl)-3-[(2,3,4,5,6-pentafluorophenyl)methyl]imidazolidin-2-one.
| Compound Name | 1-(2-methylsulfonyl-1,3-dihydroisoindol-5-yl)-3-[(2,3,4,5,6-pentafluorophenyl)methyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 3389359 |
| Molecular Formula | C19H16F5N3O3S |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 1-(2-methylsulfonyl-1,3-dihydroisoindol-5-yl)-3-[(2,3,4,5,6-pentafluorophenyl)methyl]imidazolidin-2-one |
| SMILES | CS(=O)(=O)N1Cc2ccc(N3CCN(Cc4c(F)c(F)c(F)c(F)c4F)C3=O)cc2C1 |
| InChI | InChI=1S/C19H16F5N3O3S/c1-31(29,30)26-7-10-2-3-12(6-11(10)8-26)27-5-4-25(19(27)28)9-13-14(20)16(22)18(24)17(23)15(13)21/h2-3,6H,4-5,7-9H2,1H3 |
| InChIKey | DKSMWFVGFQXIOH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|