About 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one
7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one (PubChem CID 3389424) has the molecular formula C11H8F6N2O
and a molecular weight of 298.19 g/mol. Its IUPAC name is 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one.
Molecular Properties
| Compound Name | 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one |
| PubChem CID | 3389424 |
| Molecular Formula | C11H8F6N2O |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one |
| SMILES | Cc1ccc2c(c1)NC(C(F)(F)F)(C(F)(F)F)NC2=O |
| InChI | InChI=1S/C11H8F6N2O/c1-5-2-3-6-7(4-5)18-9(10(12,13)14,11(15,16)17)19-8(6)20/h2-4,18H,1H3,(H,19,20) |
| InChIKey | SRFWDXYSPLXTAU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one?
The IUPAC name of 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one (CID 3389424) is 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one.
What is the SMILES notation for 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one?
The canonical SMILES for 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one is Cc1ccc2c(c1)NC(C(F)(F)F)(C(F)(F)F)NC2=O.
What is the InChIKey of 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one?
The InChIKey is SRFWDXYSPLXTAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F6N2O/c1-5-2-3-6-7(4-5)18-9(10(12,13)14,11(15,16)17)19-8(6)20/h2-4,18H,1H3,(H,19,20).
What are the key properties of 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one?
7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one has a molecular weight of 298.19 g/mol, XLogP of 2.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,2-bis(trifluoromethyl)-1,3-dihydroquinazolin-4-one is sourced from PubChem (CID 3389424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).