C12H19N3OS — CID 3389923
4-(2-ethoxyethyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione (PubChem CID 3389923) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 4-(2-ethoxyethyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione.
| Compound Name | 4-(2-ethoxyethyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione |
|---|---|
| PubChem CID | 3389923 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-(2-ethoxyethyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione |
| SMILES | CCOCCc1[nH]c(=S)nc2c1CCCCN2 |
| InChI | InChI=1S/C12H19N3OS/c1-2-16-8-6-10-9-5-3-4-7-13-11(9)15-12(17)14-10/h2-8H2,1H3,(H2,13,14,15,17) |
| InChIKey | PUJGKTOOBXCORT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|