C19H14ClFN4O2 — CID 3389944
9-(4-chloro-3-fluorophenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile (PubChem CID 3389944) has the molecular formula C19H14ClFN4O2 and a molecular weight of 384.80 g/mol. Its IUPAC name is 9-(4-chloro-3-fluorophenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile.
| Compound Name | 9-(4-chloro-3-fluorophenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 3389944 |
| Molecular Formula | C19H14ClFN4O2 |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 9-(4-chloro-3-fluorophenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCCCC2C1(C#N)C(C#N)(C#N)C(c1ccc(Cl)c(F)c1)O3 |
| InChI | InChI=1S/C19H14ClFN4O2/c20-12-5-4-11(7-13(12)21)15-17(8-22,9-23)18(10-24)14-3-1-2-6-19(14,26-15)27-16(18)25/h4-5,7,14-15,25H,1-3,6H2/b25-16+ |
| InChIKey | JTWVRQGVGIWJDL-PCLIKHOPSA-N |
| XLogP | 3.99 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|